About 5,5-dibromopentanimidamide
5,5-dibromopentanimidamide (PubChem CID 57012710) has the molecular formula C5H10Br2N2
and a molecular weight of 257.96 g/mol. Its IUPAC name is 5,5-dibromopentanimidamide.
Molecular Properties
| Compound Name | 5,5-dibromopentanimidamide |
| PubChem CID | 57012710 |
| Molecular Formula | C5H10Br2N2 |
| Molecular Weight | 257.96 g/mol |
| Exact Mass | 255.92 |
| IUPAC Name | 5,5-dibromopentanimidamide |
| SMILES | [H]/N=C(\N)CCCC(Br)Br |
| InChI | InChI=1S/C5H10Br2N2/c6-4(7)2-1-3-5(8)9/h4H,1-3H2,(H3,8,9) |
| InChIKey | KYHFPSFTINUECD-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.96 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dibromopentanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dibromopentanimidamide?
The IUPAC name of 5,5-dibromopentanimidamide (CID 57012710) is 5,5-dibromopentanimidamide.
What is the SMILES notation for 5,5-dibromopentanimidamide?
The canonical SMILES for 5,5-dibromopentanimidamide is [H]/N=C(\N)CCCC(Br)Br.
What is the InChIKey of 5,5-dibromopentanimidamide?
The InChIKey is KYHFPSFTINUECD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10Br2N2/c6-4(7)2-1-3-5(8)9/h4H,1-3H2,(H3,8,9).
What are the key properties of 5,5-dibromopentanimidamide?
5,5-dibromopentanimidamide has a molecular weight of 257.96 g/mol, XLogP of 2.21, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dibromopentanimidamide is sourced from PubChem (CID 57012710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).