C4H8I2N2 — CID 57304657
4,4-diiodobutanimidamide (PubChem CID 57304657) has the molecular formula C4H8I2N2 and a molecular weight of 337.93 g/mol. Its IUPAC name is 4,4-diiodobutanimidamide.
| Compound Name | 4,4-diiodobutanimidamide |
|---|---|
| PubChem CID | 57304657 |
| Molecular Formula | C4H8I2N2 |
| Molecular Weight | 337.93 g/mol |
| Exact Mass | 337.88 |
| IUPAC Name | 4,4-diiodobutanimidamide |
| SMILES | [H]/N=C(\N)CCC(I)I |
| InChI | InChI=1S/C4H8I2N2/c5-3(6)1-2-4(7)8/h3H,1-2H2,(H3,7,8) |
| InChIKey | FMBQETZXRLNMET-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.93 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|