C20H41NO6S — CID 142542042
ethane;2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethyl N-(4-sulfanylcyclohexyl)carbamate (PubChem CID 142542042) has the molecular formula C20H41NO6S and a molecular weight of 423.62 g/mol. Its IUPAC name is ethane;2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethyl N-(4-sulfanylcyclohexyl)carbamate.
| Compound Name | ethane;2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethyl N-(4-sulfanylcyclohexyl)carbamate |
|---|---|
| PubChem CID | 142542042 |
| Molecular Formula | C20H41NO6S |
| Molecular Weight | 423.62 g/mol |
| Exact Mass | 423.27 |
| IUPAC Name | ethane;2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethyl N-(4-sulfanylcyclohexyl)carbamate |
| SMILES | CC.CCCOCCOCCOCCOCCOC(=O)NC1CCC(S)CC1 |
| InChI | InChI=1S/C18H35NO6S.C2H6/c1-2-7-21-8-9-22-10-11-23-12-13-24-14-15-25-18(20)19-16-3-5-17(26)6-4-16;1-2/h16-17,26H,2-15H2,1H3,(H,19,20);1-2H3 |
| InChIKey | LBJMYFNBICDJSD-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.62 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|