C19H33NO7S — CID 142541914
2-[2-[2-[(4-methylsulfanylcyclohexyl)carbamoyloxy]ethoxy]ethoxy]ethyl 4-oxopentanoate (PubChem CID 142541914) has the molecular formula C19H33NO7S and a molecular weight of 419.54 g/mol. Its IUPAC name is 2-[2-[2-[(4-methylsulfanylcyclohexyl)carbamoyloxy]ethoxy]ethoxy]ethyl 4-oxopentanoate.
| Compound Name | 2-[2-[2-[(4-methylsulfanylcyclohexyl)carbamoyloxy]ethoxy]ethoxy]ethyl 4-oxopentanoate |
|---|---|
| PubChem CID | 142541914 |
| Molecular Formula | C19H33NO7S |
| Molecular Weight | 419.54 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 2-[2-[2-[(4-methylsulfanylcyclohexyl)carbamoyloxy]ethoxy]ethoxy]ethyl 4-oxopentanoate |
| SMILES | CSC1CCC(NC(=O)OCCOCCOCCOC(=O)CCC(C)=O)CC1 |
| InChI | InChI=1S/C19H33NO7S/c1-15(21)3-8-18(22)26-13-11-24-9-10-25-12-14-27-19(23)20-16-4-6-17(28-2)7-5-16/h16-17H,3-14H2,1-2H3,(H,20,23) |
| InChIKey | FLUZYEJETFHCQR-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.54 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|