C19H36N2O5S — CID 142541949
2-[2-[2-(propanoylamino)ethoxy]ethoxy]ethyl N-(4-propan-2-ylsulfanylcyclohexyl)carbamate (PubChem CID 142541949) has the molecular formula C19H36N2O5S and a molecular weight of 404.57 g/mol. Its IUPAC name is 2-[2-[2-(propanoylamino)ethoxy]ethoxy]ethyl N-(4-propan-2-ylsulfanylcyclohexyl)carbamate.
| Compound Name | 2-[2-[2-(propanoylamino)ethoxy]ethoxy]ethyl N-(4-propan-2-ylsulfanylcyclohexyl)carbamate |
|---|---|
| PubChem CID | 142541949 |
| Molecular Formula | C19H36N2O5S |
| Molecular Weight | 404.57 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | 2-[2-[2-(propanoylamino)ethoxy]ethoxy]ethyl N-(4-propan-2-ylsulfanylcyclohexyl)carbamate |
| SMILES | CCC(=O)NCCOCCOCCOC(=O)NC1CCC(SC(C)C)CC1 |
| InChI | InChI=1S/C19H36N2O5S/c1-4-18(22)20-9-10-24-11-12-25-13-14-26-19(23)21-16-5-7-17(8-6-16)27-15(2)3/h15-17H,4-14H2,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | WFGUVLKFVMDCSX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.57 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|