C15H30N2O4S — CID 142542009
2-[2-[2-(methylamino)ethoxy]ethoxy]ethyl N-(4-methylsulfanylcyclohexyl)carbamate (PubChem CID 142542009) has the molecular formula C15H30N2O4S and a molecular weight of 334.48 g/mol. Its IUPAC name is 2-[2-[2-(methylamino)ethoxy]ethoxy]ethyl N-(4-methylsulfanylcyclohexyl)carbamate.
| Compound Name | 2-[2-[2-(methylamino)ethoxy]ethoxy]ethyl N-(4-methylsulfanylcyclohexyl)carbamate |
|---|---|
| PubChem CID | 142542009 |
| Molecular Formula | C15H30N2O4S |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 2-[2-[2-(methylamino)ethoxy]ethoxy]ethyl N-(4-methylsulfanylcyclohexyl)carbamate |
| SMILES | CNCCOCCOCCOC(=O)NC1CCC(SC)CC1 |
| InChI | InChI=1S/C15H30N2O4S/c1-16-7-8-19-9-10-20-11-12-21-15(18)17-13-3-5-14(22-2)6-4-13/h13-14,16H,3-12H2,1-2H3,(H,17,18) |
| InChIKey | KYTZUTHDBVBPOT-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|