C7H16N2O3 — CID 87799923
2-[2-(methylamino)ethoxy]ethyl N-methylcarbamate (PubChem CID 87799923) has the molecular formula C7H16N2O3 and a molecular weight of 176.22 g/mol. Its IUPAC name is 2-[2-(methylamino)ethoxy]ethyl N-methylcarbamate.
| Compound Name | 2-[2-(methylamino)ethoxy]ethyl N-methylcarbamate |
|---|---|
| PubChem CID | 87799923 |
| Molecular Formula | C7H16N2O3 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 2-[2-(methylamino)ethoxy]ethyl N-methylcarbamate |
| SMILES | CNCCOCCOC(=O)NC |
| InChI | InChI=1S/C7H16N2O3/c1-8-3-4-11-5-6-12-7(10)9-2/h8H,3-6H2,1-2H3,(H,9,10) |
| InChIKey | INRROROZXRYOQE-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|