C13H28N2O6 — CID 142392004
2-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethyl N-methylcarbamate (PubChem CID 142392004) has the molecular formula C13H28N2O6 and a molecular weight of 308.38 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethyl N-methylcarbamate.
| Compound Name | 2-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethyl N-methylcarbamate |
|---|---|
| PubChem CID | 142392004 |
| Molecular Formula | C13H28N2O6 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | 2-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethyl N-methylcarbamate |
| SMILES | CNCCOCCOCCOCCOCCOC(=O)NC |
| InChI | InChI=1S/C13H28N2O6/c1-14-3-4-17-5-6-18-7-8-19-9-10-20-11-12-21-13(16)15-2/h14H,3-12H2,1-2H3,(H,15,16) |
| InChIKey | MTMLLTONLRICSZ-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 87.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|