C24H46N2O8S — CID 142542075
2-[2-[2-[2-[2-[2-(3-methylbutanoylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl N-(4-sulfanylcyclohexyl)carbamate (PubChem CID 142542075) has the molecular formula C24H46N2O8S and a molecular weight of 522.71 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-(3-methylbutanoylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl N-(4-sulfanylcyclohexyl)carbamate.
| Compound Name | 2-[2-[2-[2-[2-[2-(3-methylbutanoylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl N-(4-sulfanylcyclohexyl)carbamate |
|---|---|
| PubChem CID | 142542075 |
| Molecular Formula | C24H46N2O8S |
| Molecular Weight | 522.71 g/mol |
| Exact Mass | 522.30 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-(3-methylbutanoylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl N-(4-sulfanylcyclohexyl)carbamate |
| SMILES | CC(C)CC(=O)NCCOCCOCCOCCOCCOCCOC(=O)NC1CCC(S)CC1 |
| InChI | InChI=1S/C24H46N2O8S/c1-20(2)19-23(27)25-7-8-29-9-10-30-11-12-31-13-14-32-15-16-33-17-18-34-24(28)26-21-3-5-22(35)6-4-21/h20-22,35H,3-19H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | ZQEIRRSNIWWDHJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 113.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.71 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|