C16H24N2O6 — CID 59002737
2-[4-(cyclopropylamino)-4-oxobutanoyl]oxyethyl 4-(cyclopropylamino)-4-oxobutanoate (PubChem CID 59002737) has the molecular formula C16H24N2O6 and a molecular weight of 340.38 g/mol. Its IUPAC name is 2-[4-(cyclopropylamino)-4-oxobutanoyl]oxyethyl 4-(cyclopropylamino)-4-oxobutanoate.
| Compound Name | 2-[4-(cyclopropylamino)-4-oxobutanoyl]oxyethyl 4-(cyclopropylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 59002737 |
| Molecular Formula | C16H24N2O6 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 2-[4-(cyclopropylamino)-4-oxobutanoyl]oxyethyl 4-(cyclopropylamino)-4-oxobutanoate |
| SMILES | O=C(CCC(=O)OCCOC(=O)CCC(=O)NC1CC1)NC1CC1 |
| InChI | InChI=1S/C16H24N2O6/c19-13(17-11-1-2-11)5-7-15(21)23-9-10-24-16(22)8-6-14(20)18-12-3-4-12/h11-12H,1-10H2,(H,17,19)(H,18,20) |
| InChIKey | RGOMMMVYSZZCAQ-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|