C13H22N2O4 — CID 60728078
ethyl 4-[(4-carbamoylcyclohexyl)amino]-4-oxobutanoate (PubChem CID 60728078) has the molecular formula C13H22N2O4 and a molecular weight of 270.33 g/mol. Its IUPAC name is ethyl 4-[(4-carbamoylcyclohexyl)amino]-4-oxobutanoate.
| Compound Name | ethyl 4-[(4-carbamoylcyclohexyl)amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 60728078 |
| Molecular Formula | C13H22N2O4 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | ethyl 4-[(4-carbamoylcyclohexyl)amino]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)NC1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C13H22N2O4/c1-2-19-12(17)8-7-11(16)15-10-5-3-9(4-6-10)13(14)18/h9-10H,2-8H2,1H3,(H2,14,18)(H,15,16) |
| InChIKey | BTAZRLKLKUNIFZ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |