C12H19NO5S — CID 114233111
ethyl 5-[2-(cyclopropylamino)-2-oxoethyl]sulfinyl-4-oxopentanoate (PubChem CID 114233111) has the molecular formula C12H19NO5S and a molecular weight of 289.35 g/mol. Its IUPAC name is ethyl 5-[2-(cyclopropylamino)-2-oxoethyl]sulfinyl-4-oxopentanoate.
| Compound Name | ethyl 5-[2-(cyclopropylamino)-2-oxoethyl]sulfinyl-4-oxopentanoate |
|---|---|
| PubChem CID | 114233111 |
| Molecular Formula | C12H19NO5S |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | ethyl 5-[2-(cyclopropylamino)-2-oxoethyl]sulfinyl-4-oxopentanoate |
| SMILES | CCOC(=O)CCC(=O)CS(=O)CC(=O)NC1CC1 |
| InChI | InChI=1S/C12H19NO5S/c1-2-18-12(16)6-5-10(14)7-19(17)8-11(15)13-9-3-4-9/h9H,2-8H2,1H3,(H,13,15) |
| InChIKey | MNYOEIJUPXTUNS-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |