About propyl N-(oxan-4-yl)carbamate
propyl N-(oxan-4-yl)carbamate (PubChem CID 89062839) has the molecular formula C9H17NO3
and a molecular weight of 187.24 g/mol. Its IUPAC name is propyl N-(oxan-4-yl)carbamate.
Molecular Properties
| Compound Name | propyl N-(oxan-4-yl)carbamate |
| PubChem CID | 89062839 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | propyl N-(oxan-4-yl)carbamate |
| SMILES | CCCOC(=O)NC1CCOCC1 |
| InChI | InChI=1S/C9H17NO3/c1-2-5-13-9(11)10-8-3-6-12-7-4-8/h8H,2-7H2,1H3,(H,10,11) |
| InChIKey | CNVNXXMJIXAHSA-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propyl N-(oxan-4-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl N-(oxan-4-yl)carbamate?
The IUPAC name of propyl N-(oxan-4-yl)carbamate (CID 89062839) is propyl N-(oxan-4-yl)carbamate.
What is the SMILES notation for propyl N-(oxan-4-yl)carbamate?
The canonical SMILES for propyl N-(oxan-4-yl)carbamate is CCCOC(=O)NC1CCOCC1.
What is the InChIKey of propyl N-(oxan-4-yl)carbamate?
The InChIKey is CNVNXXMJIXAHSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO3/c1-2-5-13-9(11)10-8-3-6-12-7-4-8/h8H,2-7H2,1H3,(H,10,11).
What are the key properties of propyl N-(oxan-4-yl)carbamate?
propyl N-(oxan-4-yl)carbamate has a molecular weight of 187.24 g/mol, XLogP of 1.30, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propyl N-(oxan-4-yl)carbamate is sourced from PubChem (CID 89062839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).