About 1,4-dioxane;propyl acetate
1,4-dioxane;propyl acetate (PubChem CID 175904489) has the molecular formula C9H18O4
and a molecular weight of 190.24 g/mol. Its IUPAC name is 1,4-dioxane;propyl acetate.
Molecular Properties
| Compound Name | 1,4-dioxane;propyl acetate |
| PubChem CID | 175904489 |
| Molecular Formula | C9H18O4 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 1,4-dioxane;propyl acetate |
| SMILES | C1COCCO1.CCCOC(C)=O |
| InChI | InChI=1S/C5H10O2.C4H8O2/c1-3-4-7-5(2)6;1-2-6-4-3-5-1/h3-4H2,1-2H3;1-4H2 |
| InChIKey | NUHPGFPPAQGQBO-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,4-dioxane;propyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dioxane;propyl acetate?
The IUPAC name of 1,4-dioxane;propyl acetate (CID 175904489) is 1,4-dioxane;propyl acetate.
What is the SMILES notation for 1,4-dioxane;propyl acetate?
The canonical SMILES for 1,4-dioxane;propyl acetate is C1COCCO1.CCCOC(C)=O.
What is the InChIKey of 1,4-dioxane;propyl acetate?
The InChIKey is NUHPGFPPAQGQBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O2.C4H8O2/c1-3-4-7-5(2)6;1-2-6-4-3-5-1/h3-4H2,1-2H3;1-4H2.
What are the key properties of 1,4-dioxane;propyl acetate?
1,4-dioxane;propyl acetate has a molecular weight of 190.24 g/mol, XLogP of 0.99, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dioxane;propyl acetate is sourced from PubChem (CID 175904489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).