C20H36N2O7 — CID 142542047
2-[2-[2-[2-(4-oxopentanoylamino)ethoxy]ethoxy]ethoxy]ethyl 4-methylpiperidine-1-carboxylate (PubChem CID 142542047) has the molecular formula C20H36N2O7 and a molecular weight of 416.52 g/mol. Its IUPAC name is 2-[2-[2-[2-(4-oxopentanoylamino)ethoxy]ethoxy]ethoxy]ethyl 4-methylpiperidine-1-carboxylate.
| Compound Name | 2-[2-[2-[2-(4-oxopentanoylamino)ethoxy]ethoxy]ethoxy]ethyl 4-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 142542047 |
| Molecular Formula | C20H36N2O7 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | 2-[2-[2-[2-(4-oxopentanoylamino)ethoxy]ethoxy]ethoxy]ethyl 4-methylpiperidine-1-carboxylate |
| SMILES | CC(=O)CCC(=O)NCCOCCOCCOCCOC(=O)N1CCC(C)CC1 |
| InChI | InChI=1S/C20H36N2O7/c1-17-5-8-22(9-6-17)20(25)29-16-15-28-14-13-27-12-11-26-10-7-21-19(24)4-3-18(2)23/h17H,3-16H2,1-2H3,(H,21,24) |
| InChIKey | CMXRGRQSAPCBTM-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|