C23H43NO9S — CID 142541989
ethane;2-[2-[2-[2-[2-(4-oxopentanoyloxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-sulfanylpiperidine-1-carboxylate (PubChem CID 142541989) has the molecular formula C23H43NO9S and a molecular weight of 509.66 g/mol. Its IUPAC name is ethane;2-[2-[2-[2-[2-(4-oxopentanoyloxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-sulfanylpiperidine-1-carboxylate.
| Compound Name | ethane;2-[2-[2-[2-[2-(4-oxopentanoyloxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-sulfanylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 142541989 |
| Molecular Formula | C23H43NO9S |
| Molecular Weight | 509.66 g/mol |
| Exact Mass | 509.27 |
| IUPAC Name | ethane;2-[2-[2-[2-[2-(4-oxopentanoyloxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-sulfanylpiperidine-1-carboxylate |
| SMILES | CC.CC(=O)CCC(=O)OCCOCCOCCOCCOCCOC(=O)N1CCC(S)CC1 |
| InChI | InChI=1S/C21H37NO9S.C2H6/c1-18(23)2-3-20(24)30-16-14-28-12-10-26-8-9-27-11-13-29-15-17-31-21(25)22-6-4-19(32)5-7-22;1-2/h19,32H,2-17H2,1H3;1-2H3 |
| InChIKey | NBJRIJBITRYEFT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 109.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.66 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|