C19H34N2O7S — CID 142541755
2-[2-[2-[2-(4-oxopentanoylamino)ethoxy]ethoxy]ethoxy]ethyl 4-sulfanylpiperidine-1-carboxylate (PubChem CID 142541755) has the molecular formula C19H34N2O7S and a molecular weight of 434.56 g/mol. Its IUPAC name is 2-[2-[2-[2-(4-oxopentanoylamino)ethoxy]ethoxy]ethoxy]ethyl 4-sulfanylpiperidine-1-carboxylate.
| Compound Name | 2-[2-[2-[2-(4-oxopentanoylamino)ethoxy]ethoxy]ethoxy]ethyl 4-sulfanylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 142541755 |
| Molecular Formula | C19H34N2O7S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 2-[2-[2-[2-(4-oxopentanoylamino)ethoxy]ethoxy]ethoxy]ethyl 4-sulfanylpiperidine-1-carboxylate |
| SMILES | CC(=O)CCC(=O)NCCOCCOCCOCCOC(=O)N1CCC(S)CC1 |
| InChI | InChI=1S/C19H34N2O7S/c1-16(22)2-3-18(23)20-6-9-25-10-11-26-12-13-27-14-15-28-19(24)21-7-4-17(29)5-8-21/h17,29H,2-15H2,1H3,(H,20,23) |
| InChIKey | NIANSLKPAPLRNQ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|