C12H21NO2S — CID 103713860
N-(3-ethylsulfanylcyclopentyl)-4-oxopentanamide (PubChem CID 103713860) has the molecular formula C12H21NO2S and a molecular weight of 243.37 g/mol. Its IUPAC name is N-(3-ethylsulfanylcyclopentyl)-4-oxopentanamide.
| Compound Name | N-(3-ethylsulfanylcyclopentyl)-4-oxopentanamide |
|---|---|
| PubChem CID | 103713860 |
| Molecular Formula | C12H21NO2S |
| Molecular Weight | 243.37 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | N-(3-ethylsulfanylcyclopentyl)-4-oxopentanamide |
| SMILES | CCSC1CCC(NC(=O)CCC(C)=O)C1 |
| InChI | InChI=1S/C12H21NO2S/c1-3-16-11-6-5-10(8-11)13-12(15)7-4-9(2)14/h10-11H,3-8H2,1-2H3,(H,13,15) |
| InChIKey | WAEHDLJLVAQNAC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.37 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |