C11H18N2OS — CID 103713466
2-cyano-N-(3-ethylsulfanylcyclopentyl)propanamide (PubChem CID 103713466) has the molecular formula C11H18N2OS and a molecular weight of 226.34 g/mol. Its IUPAC name is 2-cyano-N-(3-ethylsulfanylcyclopentyl)propanamide.
| Compound Name | 2-cyano-N-(3-ethylsulfanylcyclopentyl)propanamide |
|---|---|
| PubChem CID | 103713466 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 2-cyano-N-(3-ethylsulfanylcyclopentyl)propanamide |
| SMILES | CCSC1CCC(NC(=O)C(C)C#N)C1 |
| InChI | InChI=1S/C11H18N2OS/c1-3-15-10-5-4-9(6-10)13-11(14)8(2)7-12/h8-10H,3-6H2,1-2H3,(H,13,14) |
| InChIKey | JJQOGYUVDZZDMZ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |