C12H22N2OS2 — CID 114123292
3-amino-N-(3-ethylsulfanylcyclopentyl)-2,2-dimethyl-3-sulfanylidenepropanamide (PubChem CID 114123292) has the molecular formula C12H22N2OS2 and a molecular weight of 274.45 g/mol. Its IUPAC name is 3-amino-N-(3-ethylsulfanylcyclopentyl)-2,2-dimethyl-3-sulfanylidenepropanamide.
| Compound Name | 3-amino-N-(3-ethylsulfanylcyclopentyl)-2,2-dimethyl-3-sulfanylidenepropanamide |
|---|---|
| PubChem CID | 114123292 |
| Molecular Formula | C12H22N2OS2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 3-amino-N-(3-ethylsulfanylcyclopentyl)-2,2-dimethyl-3-sulfanylidenepropanamide |
| SMILES | CCSC1CCC(NC(=O)C(C)(C)C(N)=S)C1 |
| InChI | InChI=1S/C12H22N2OS2/c1-4-17-9-6-5-8(7-9)14-11(15)12(2,3)10(13)16/h8-9H,4-7H2,1-3H3,(H2,13,16)(H,14,15) |
| InChIKey | IKKBSPSLTSOQFI-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|