C10H21ClN2OS — CID 119343755
2-amino-N-(3-ethylsulfanylcyclohexyl)acetamide;hydrochloride (PubChem CID 119343755) has the molecular formula C10H21ClN2OS and a molecular weight of 252.81 g/mol. Its IUPAC name is 2-amino-N-(3-ethylsulfanylcyclohexyl)acetamide;hydrochloride.
| Compound Name | 2-amino-N-(3-ethylsulfanylcyclohexyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119343755 |
| Molecular Formula | C10H21ClN2OS |
| Molecular Weight | 252.81 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 2-amino-N-(3-ethylsulfanylcyclohexyl)acetamide;hydrochloride |
| SMILES | CCSC1CCCC(NC(=O)CN)C1.Cl |
| InChI | InChI=1S/C10H20N2OS.ClH/c1-2-14-9-5-3-4-8(6-9)12-10(13)7-11;/h8-9H,2-7,11H2,1H3,(H,12,13);1H |
| InChIKey | WVGPJWXRUJHFBI-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.81 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |