C16H20F2N2O3S — CID 124885342
2-(2,6-difluoro-4-nitrophenyl)-N-[(1S,3S)-3-ethylsulfanylcyclohexyl]acetamide (PubChem CID 124885342) has the molecular formula C16H20F2N2O3S and a molecular weight of 358.41 g/mol. Its IUPAC name is 2-(2,6-difluoro-4-nitrophenyl)-N-[(1S,3S)-3-ethylsulfanylcyclohexyl]acetamide.
| Compound Name | 2-(2,6-difluoro-4-nitrophenyl)-N-[(1S,3S)-3-ethylsulfanylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 124885342 |
| Molecular Formula | C16H20F2N2O3S |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 2-(2,6-difluoro-4-nitrophenyl)-N-[(1S,3S)-3-ethylsulfanylcyclohexyl]acetamide |
| SMILES | CCS[C@H]1CCC[C@H](NC(=O)Cc2c(F)cc([N+](=O)[O-])cc2F)C1 |
| InChI | InChI=1S/C16H20F2N2O3S/c1-2-24-12-5-3-4-10(6-12)19-16(21)9-13-14(17)7-11(20(22)23)8-15(13)18/h7-8,10,12H,2-6,9H2,1H3,(H,19,21)/t10-,12-/m0/s1 |
| InChIKey | BDMMQOYHBCPOGP-JQWIXIFHSA-N |
| XLogP | 3.60 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|