C15H23ClN2OS — CID 119945965
2-amino-N-(3-ethylsulfanylcyclohexyl)benzamide;hydrochloride (PubChem CID 119945965) has the molecular formula C15H23ClN2OS and a molecular weight of 314.88 g/mol. Its IUPAC name is 2-amino-N-(3-ethylsulfanylcyclohexyl)benzamide;hydrochloride.
| Compound Name | 2-amino-N-(3-ethylsulfanylcyclohexyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119945965 |
| Molecular Formula | C15H23ClN2OS |
| Molecular Weight | 314.88 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 2-amino-N-(3-ethylsulfanylcyclohexyl)benzamide;hydrochloride |
| SMILES | CCSC1CCCC(NC(=O)c2ccccc2N)C1.Cl |
| InChI | InChI=1S/C15H22N2OS.ClH/c1-2-19-12-7-5-6-11(10-12)17-15(18)13-8-3-4-9-14(13)16;/h3-4,8-9,11-12H,2,5-7,10,16H2,1H3,(H,17,18);1H |
| InChIKey | DNLTVQMEDZMTPV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.88 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|