C14H17BrFNOS — CID 106544630
3-bromo-N-(3-ethylsulfanylcyclopentyl)-2-fluorobenzamide (PubChem CID 106544630) has the molecular formula C14H17BrFNOS and a molecular weight of 346.27 g/mol. Its IUPAC name is 3-bromo-N-(3-ethylsulfanylcyclopentyl)-2-fluorobenzamide.
| Compound Name | 3-bromo-N-(3-ethylsulfanylcyclopentyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 106544630 |
| Molecular Formula | C14H17BrFNOS |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | 3-bromo-N-(3-ethylsulfanylcyclopentyl)-2-fluorobenzamide |
| SMILES | CCSC1CCC(NC(=O)c2cccc(Br)c2F)C1 |
| InChI | InChI=1S/C14H17BrFNOS/c1-2-19-10-7-6-9(8-10)17-14(18)11-4-3-5-12(15)13(11)16/h3-5,9-10H,2,6-8H2,1H3,(H,17,18) |
| InChIKey | UJXJMFGRCJRLRW-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |