C13H19BrN4OS — CID 114124045
5-bromo-N-(3-ethylsulfanylcyclopentyl)-2-hydrazinylpyridine-3-carboxamide (PubChem CID 114124045) has the molecular formula C13H19BrN4OS and a molecular weight of 359.29 g/mol. Its IUPAC name is 5-bromo-N-(3-ethylsulfanylcyclopentyl)-2-hydrazinylpyridine-3-carboxamide.
| Compound Name | 5-bromo-N-(3-ethylsulfanylcyclopentyl)-2-hydrazinylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 114124045 |
| Molecular Formula | C13H19BrN4OS |
| Molecular Weight | 359.29 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | 5-bromo-N-(3-ethylsulfanylcyclopentyl)-2-hydrazinylpyridine-3-carboxamide |
| SMILES | CCSC1CCC(NC(=O)c2cc(Br)cnc2NN)C1 |
| InChI | InChI=1S/C13H19BrN4OS/c1-2-20-10-4-3-9(6-10)17-13(19)11-5-8(14)7-16-12(11)18-15/h5,7,9-10H,2-4,6,15H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | MRSGHNKQXYBAIM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|