C12H17BrN2S — CID 103704828
5-bromo-N-(3-ethylsulfanylcyclopentyl)pyridin-2-amine (PubChem CID 103704828) has the molecular formula C12H17BrN2S and a molecular weight of 301.25 g/mol. Its IUPAC name is 5-bromo-N-(3-ethylsulfanylcyclopentyl)pyridin-2-amine.
| Compound Name | 5-bromo-N-(3-ethylsulfanylcyclopentyl)pyridin-2-amine |
|---|---|
| PubChem CID | 103704828 |
| Molecular Formula | C12H17BrN2S |
| Molecular Weight | 301.25 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 5-bromo-N-(3-ethylsulfanylcyclopentyl)pyridin-2-amine |
| SMILES | CCSC1CCC(Nc2ccc(Br)cn2)C1 |
| InChI | InChI=1S/C12H17BrN2S/c1-2-16-11-5-4-10(7-11)15-12-6-3-9(13)8-14-12/h3,6,8,10-11H,2,4-5,7H2,1H3,(H,14,15) |
| InChIKey | PDAMOFCUMREBSP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.25 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |