C12H17N3O2S — CID 113244226
N-(3-ethylsulfanylcyclopentyl)-5-nitropyridin-2-amine (PubChem CID 113244226) has the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. Its IUPAC name is N-(3-ethylsulfanylcyclopentyl)-5-nitropyridin-2-amine.
| Compound Name | N-(3-ethylsulfanylcyclopentyl)-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 113244226 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | N-(3-ethylsulfanylcyclopentyl)-5-nitropyridin-2-amine |
| SMILES | CCSC1CCC(Nc2ccc([N+](=O)[O-])cn2)C1 |
| InChI | InChI=1S/C12H17N3O2S/c1-2-18-11-5-3-9(7-11)14-12-6-4-10(8-13-12)15(16)17/h4,6,8-9,11H,2-3,5,7H2,1H3,(H,13,14) |
| InChIKey | CCQNZSIFSSMFDZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|