About (1-butylpiperidin-4-yl) N-(2-hydroxyethyl)carbamate
(1-butylpiperidin-4-yl) N-(2-hydroxyethyl)carbamate (PubChem CID 23171365) has the molecular formula C12H24N2O3
and a molecular weight of 244.33 g/mol. Its IUPAC name is (1-butylpiperidin-4-yl) N-(2-hydroxyethyl)carbamate.
Molecular Properties
| Compound Name | (1-butylpiperidin-4-yl) N-(2-hydroxyethyl)carbamate |
| PubChem CID | 23171365 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | (1-butylpiperidin-4-yl) N-(2-hydroxyethyl)carbamate |
| SMILES | CCCCN1CCC(OC(=O)NCCO)CC1 |
| InChI | InChI=1S/C12H24N2O3/c1-2-3-7-14-8-4-11(5-9-14)17-12(16)13-6-10-15/h11,15H,2-10H2,1H3,(H,13,16) |
| InChIKey | PORJGFWGBZEFHY-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1-butylpiperidin-4-yl) N-(2-hydroxyethyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-butylpiperidin-4-yl) N-(2-hydroxyethyl)carbamate?
The IUPAC name of (1-butylpiperidin-4-yl) N-(2-hydroxyethyl)carbamate (CID 23171365) is (1-butylpiperidin-4-yl) N-(2-hydroxyethyl)carbamate.
What is the SMILES notation for (1-butylpiperidin-4-yl) N-(2-hydroxyethyl)carbamate?
The canonical SMILES for (1-butylpiperidin-4-yl) N-(2-hydroxyethyl)carbamate is CCCCN1CCC(OC(=O)NCCO)CC1.
What is the InChIKey of (1-butylpiperidin-4-yl) N-(2-hydroxyethyl)carbamate?
The InChIKey is PORJGFWGBZEFHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O3/c1-2-3-7-14-8-4-11(5-9-14)17-12(16)13-6-10-15/h11,15H,2-10H2,1H3,(H,13,16).
What are the key properties of (1-butylpiperidin-4-yl) N-(2-hydroxyethyl)carbamate?
(1-butylpiperidin-4-yl) N-(2-hydroxyethyl)carbamate has a molecular weight of 244.33 g/mol, XLogP of 0.97, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-butylpiperidin-4-yl) N-(2-hydroxyethyl)carbamate is sourced from PubChem (CID 23171365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).