C46H90N6O6 — CID 90879309
1,2,2,6,6-pentamethylpiperidin-4-ol;(1,2,2,6,6-pentamethylpiperidin-4-yl) N-heptylcarbamate;(1,2,2,6,6-pentamethylpiperidin-4-yl) N-(6-isocyanatohexyl)carbamate (PubChem CID 90879309) has the molecular formula C46H90N6O6 and a molecular weight of 823.26 g/mol. Its IUPAC name is 1,2,2,6,6-pentamethylpiperidin-4-ol;(1,2,2,6,6-pentamethylpiperidin-4-yl) N-heptylcarbamate;(1,2,2,6,6-pentamethylpiperidin-4-yl) N-(6-isocyanatohexyl)carbamate.
| Compound Name | 1,2,2,6,6-pentamethylpiperidin-4-ol;(1,2,2,6,6-pentamethylpiperidin-4-yl) N-heptylcarbamate;(1,2,2,6,6-pentamethylpiperidin-4-yl) N-(6-isocyanatohexyl)carbamate |
|---|---|
| PubChem CID | 90879309 |
| Molecular Formula | C46H90N6O6 |
| Molecular Weight | 823.26 g/mol |
| Exact Mass | 822.69 |
| IUPAC Name | 1,2,2,6,6-pentamethylpiperidin-4-ol;(1,2,2,6,6-pentamethylpiperidin-4-yl) N-heptylcarbamate;(1,2,2,6,6-pentamethylpiperidin-4-yl) N-(6-isocyanatohexyl)carbamate |
| SMILES | CCCCCCCNC(=O)OC1CC(C)(C)N(C)C(C)(C)C1.CN1C(C)(C)CC(O)CC1(C)C.CN1C(C)(C)CC(OC(=O)NCCCCCCN=C=O)CC1(C)C |
| InChI | InChI=1S/C18H33N3O3.C18H36N2O2.C10H21NO/c1-17(2)12-15(13-18(3,4)21(17)5)24-16(23)20-11-9-7-6-8-10-19-14-22;1-7-8-9-10-11-12-19-16(21)22-15-13-17(2,3)20(6)18(4,5)14-15;1-9(2)6-8(12)7-10(3,4)11(9)5/h15H,6-13H2,1-5H3,(H,20,23);15H,7-14H2,1-6H3,(H,19,21);8,12H,6-7H2,1-5H3 |
| InChIKey | NMCFHJBYPSZLNB-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.26 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|