C18H31NO9 — CID 67948772
butane-1,2,3,4-tetracarboxylic acid;1,2,2,6,6-pentamethylpiperidin-4-ol (PubChem CID 67948772) has the molecular formula C18H31NO9 and a molecular weight of 405.44 g/mol. Its IUPAC name is butane-1,2,3,4-tetracarboxylic acid;1,2,2,6,6-pentamethylpiperidin-4-ol.
| Compound Name | butane-1,2,3,4-tetracarboxylic acid;1,2,2,6,6-pentamethylpiperidin-4-ol |
|---|---|
| PubChem CID | 67948772 |
| Molecular Formula | C18H31NO9 |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | butane-1,2,3,4-tetracarboxylic acid;1,2,2,6,6-pentamethylpiperidin-4-ol |
| SMILES | CN1C(C)(C)CC(O)CC1(C)C.O=C(O)CC(C(=O)O)C(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H21NO.C8H10O8/c1-9(2)6-8(12)7-10(3,4)11(9)5;9-5(10)1-3(7(13)14)4(8(15)16)2-6(11)12/h8,12H,6-7H2,1-5H3;3-4H,1-2H2,(H,9,10)(H,11,12)(H,13,14)(H,15,16) |
| InChIKey | XGPPWVKCLRFPKC-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 172.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |