C31H55NO8 — CID 67514310
5-oxo-5-[13-(1,2,2,6,6-pentamethylpiperidin-4-yl)tridecan-4-yloxy]pentane-1,2,3-tricarboxylic acid (PubChem CID 67514310) has the molecular formula C31H55NO8 and a molecular weight of 569.78 g/mol. Its IUPAC name is 5-oxo-5-[13-(1,2,2,6,6-pentamethylpiperidin-4-yl)tridecan-4-yloxy]pentane-1,2,3-tricarboxylic acid.
| Compound Name | 5-oxo-5-[13-(1,2,2,6,6-pentamethylpiperidin-4-yl)tridecan-4-yloxy]pentane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 67514310 |
| Molecular Formula | C31H55NO8 |
| Molecular Weight | 569.78 g/mol |
| Exact Mass | 569.39 |
| IUPAC Name | 5-oxo-5-[13-(1,2,2,6,6-pentamethylpiperidin-4-yl)tridecan-4-yloxy]pentane-1,2,3-tricarboxylic acid |
| SMILES | CCCC(CCCCCCCCCC1CC(C)(C)N(C)C(C)(C)C1)OC(=O)CC(C(=O)O)C(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C31H55NO8/c1-7-15-23(40-27(35)19-25(29(38)39)24(28(36)37)18-26(33)34)17-14-12-10-8-9-11-13-16-22-20-30(2,3)32(6)31(4,5)21-22/h22-25H,7-21H2,1-6H3,(H,33,34)(H,36,37)(H,38,39) |
| InChIKey | DBUMFLUHZMXRCC-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 141.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.78 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|