C20H42N3NaO — CID 175384927
sodium;1,2,2,6,6-pentamethyl-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)piperidin-4-amine;hydroxide (PubChem CID 175384927) has the molecular formula C20H42N3NaO and a molecular weight of 363.57 g/mol. Its IUPAC name is sodium;1,2,2,6,6-pentamethyl-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)piperidin-4-amine;hydroxide.
| Compound Name | sodium;1,2,2,6,6-pentamethyl-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)piperidin-4-amine;hydroxide |
|---|---|
| PubChem CID | 175384927 |
| Molecular Formula | C20H42N3NaO |
| Molecular Weight | 363.57 g/mol |
| Exact Mass | 363.32 |
| IUPAC Name | sodium;1,2,2,6,6-pentamethyl-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)piperidin-4-amine;hydroxide |
| SMILES | CN1C(C)(C)CC(NC2CC(C)(C)N(C)C(C)(C)C2)CC1(C)C.[Na+].[OH-] |
| InChI | InChI=1S/C20H41N3.Na.H2O/c1-17(2)11-15(12-18(3,4)22(17)9)21-16-13-19(5,6)23(10)20(7,8)14-16;;/h15-16,21H,11-14H2,1-10H3;;1H2/q;+1;/p-1 |
| InChIKey | GAIUGUZJWAUSHD-UHFFFAOYSA-M |
| XLogP | 0.71 |
| TPSA | 48.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.57 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |