C61H102N2O6 — CID 175071124
bis[5-(3,5-ditert-butyl-4-hydroxyphenyl)-5-(1,2,2,5,6-pentamethylpiperidin-4-yl)pentyl] propanedioate (PubChem CID 175071124) has the molecular formula C61H102N2O6 and a molecular weight of 959.49 g/mol. Its IUPAC name is bis[5-(3,5-ditert-butyl-4-hydroxyphenyl)-5-(1,2,2,5,6-pentamethylpiperidin-4-yl)pentyl] propanedioate.
| Compound Name | bis[5-(3,5-ditert-butyl-4-hydroxyphenyl)-5-(1,2,2,5,6-pentamethylpiperidin-4-yl)pentyl] propanedioate |
|---|---|
| PubChem CID | 175071124 |
| Molecular Formula | C61H102N2O6 |
| Molecular Weight | 959.49 g/mol |
| Exact Mass | 958.77 |
| IUPAC Name | bis[5-(3,5-ditert-butyl-4-hydroxyphenyl)-5-(1,2,2,5,6-pentamethylpiperidin-4-yl)pentyl] propanedioate |
| SMILES | CC1C(C(CCCCOC(=O)CC(=O)OCCCCC(c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)C2CC(C)(C)N(C)C(C)C2C)c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)CC(C)(C)N(C)C1C |
| InChI | InChI=1S/C61H102N2O6/c1-38-40(3)62(21)60(17,18)36-46(38)44(42-31-48(56(5,6)7)54(66)49(32-42)57(8,9)10)27-23-25-29-68-52(64)35-53(65)69-30-26-24-28-45(47-37-61(19,20)63(22)41(4)39(47)2)43-33-50(58(11,12)13)55(67)51(34-43)59(14,15)16/h31-34,38-41,44-47,66-67H,23-30,35-37H2,1-22H3 |
| InChIKey | PLQFIYAJIUWGCM-UHFFFAOYSA-N |
| XLogP | 14.48 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 959.49 |
| LogP ≤ 5 | 14.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|