C42H72N2O5 — CID 87060378
2-[4,4-bis(1,2,2,6,6-pentamethylpiperidin-3-yl)butyl]-2-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]propanedioic acid (PubChem CID 87060378) has the molecular formula C42H72N2O5 and a molecular weight of 685.05 g/mol. Its IUPAC name is 2-[4,4-bis(1,2,2,6,6-pentamethylpiperidin-3-yl)butyl]-2-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]propanedioic acid.
| Compound Name | 2-[4,4-bis(1,2,2,6,6-pentamethylpiperidin-3-yl)butyl]-2-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]propanedioic acid |
|---|---|
| PubChem CID | 87060378 |
| Molecular Formula | C42H72N2O5 |
| Molecular Weight | 685.05 g/mol |
| Exact Mass | 684.54 |
| IUPAC Name | 2-[4,4-bis(1,2,2,6,6-pentamethylpiperidin-3-yl)butyl]-2-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]propanedioic acid |
| SMILES | CN1C(C)(C)CCC(C(CCCC(Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2O)(C(=O)O)C(=O)O)C2CCC(C)(C)N(C)C2(C)C)C1(C)C |
| InChI | InChI=1S/C42H72N2O5/c1-36(2,3)28-24-27(33(45)32(25-28)37(4,5)6)26-42(34(46)47,35(48)49)21-17-18-29(30-19-22-38(7,8)43(15)40(30,11)12)31-20-23-39(9,10)44(16)41(31,13)14/h24-25,29-31,45H,17-23,26H2,1-16H3,(H,46,47)(H,48,49) |
| InChIKey | PHELWGLAZMNQAC-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.05 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|