C31H58N2O4 — CID 66650760
2-[4,4-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)butyl]-2-butylpropanedioic acid (PubChem CID 66650760) has the molecular formula C31H58N2O4 and a molecular weight of 522.82 g/mol. Its IUPAC name is 2-[4,4-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)butyl]-2-butylpropanedioic acid.
| Compound Name | 2-[4,4-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)butyl]-2-butylpropanedioic acid |
|---|---|
| PubChem CID | 66650760 |
| Molecular Formula | C31H58N2O4 |
| Molecular Weight | 522.82 g/mol |
| Exact Mass | 522.44 |
| IUPAC Name | 2-[4,4-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)butyl]-2-butylpropanedioic acid |
| SMILES | CCCCC(CCCC(C1CC(C)(C)N(C)C(C)(C)C1)C1CC(C)(C)N(C)C(C)(C)C1)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C31H58N2O4/c1-12-13-16-31(25(34)35,26(36)37)17-14-15-24(22-18-27(2,3)32(10)28(4,5)19-22)23-20-29(6,7)33(11)30(8,9)21-23/h22-24H,12-21H2,1-11H3,(H,34,35)(H,36,37) |
| InChIKey | JRVCUDPXFUACCC-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.82 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|