C27H48N4O8 — CID 57201141
2-[4,4-bis(1-carbamoyloxy-2,2,6,6-tetramethylpiperidin-4-yl)butyl]propanedioic acid (PubChem CID 57201141) has the molecular formula C27H48N4O8 and a molecular weight of 556.70 g/mol. Its IUPAC name is 2-[4,4-bis(1-carbamoyloxy-2,2,6,6-tetramethylpiperidin-4-yl)butyl]propanedioic acid.
| Compound Name | 2-[4,4-bis(1-carbamoyloxy-2,2,6,6-tetramethylpiperidin-4-yl)butyl]propanedioic acid |
|---|---|
| PubChem CID | 57201141 |
| Molecular Formula | C27H48N4O8 |
| Molecular Weight | 556.70 g/mol |
| Exact Mass | 556.35 |
| IUPAC Name | 2-[4,4-bis(1-carbamoyloxy-2,2,6,6-tetramethylpiperidin-4-yl)butyl]propanedioic acid |
| SMILES | CC1(C)CC(C(CCCC(C(=O)O)C(=O)O)C2CC(C)(C)N(OC(N)=O)C(C)(C)C2)CC(C)(C)N1OC(N)=O |
| InChI | InChI=1S/C27H48N4O8/c1-24(2)12-16(13-25(3,4)30(24)38-22(28)36)18(10-9-11-19(20(32)33)21(34)35)17-14-26(5,6)31(39-23(29)37)27(7,8)15-17/h16-19H,9-15H2,1-8H3,(H2,28,36)(H2,29,37)(H,32,33)(H,34,35) |
| InChIKey | ONNXQSCRQQNXTA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 185.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.70 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|