C16H23N3O4 — CID 139790013
(4-carbamoyloxy-3,3,5,5-tetramethylpiperazin-1-yl) benzoate (PubChem CID 139790013) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is (4-carbamoyloxy-3,3,5,5-tetramethylpiperazin-1-yl) benzoate.
| Compound Name | (4-carbamoyloxy-3,3,5,5-tetramethylpiperazin-1-yl) benzoate |
|---|---|
| PubChem CID | 139790013 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | (4-carbamoyloxy-3,3,5,5-tetramethylpiperazin-1-yl) benzoate |
| SMILES | CC1(C)CN(OC(=O)c2ccccc2)CC(C)(C)N1OC(N)=O |
| InChI | InChI=1S/C16H23N3O4/c1-15(2)10-18(11-16(3,4)19(15)23-14(17)21)22-13(20)12-8-6-5-7-9-12/h5-9H,10-11H2,1-4H3,(H2,17,21) |
| InChIKey | OZTWJDXGRIIOTD-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |