C29H42N4O3S2 — CID 168860197
bis(3,3,5,5-tetramethyl-4-phenylsulfanylpiperazin-1-yl) carbonate (PubChem CID 168860197) has the molecular formula C29H42N4O3S2 and a molecular weight of 558.81 g/mol. Its IUPAC name is bis(3,3,5,5-tetramethyl-4-phenylsulfanylpiperazin-1-yl) carbonate.
| Compound Name | bis(3,3,5,5-tetramethyl-4-phenylsulfanylpiperazin-1-yl) carbonate |
|---|---|
| PubChem CID | 168860197 |
| Molecular Formula | C29H42N4O3S2 |
| Molecular Weight | 558.81 g/mol |
| Exact Mass | 558.27 |
| IUPAC Name | bis(3,3,5,5-tetramethyl-4-phenylsulfanylpiperazin-1-yl) carbonate |
| SMILES | CC1(C)CN(OC(=O)ON2CC(C)(C)N(Sc3ccccc3)C(C)(C)C2)CC(C)(C)N1Sc1ccccc1 |
| InChI | InChI=1S/C29H42N4O3S2/c1-26(2)19-30(20-27(3,4)32(26)37-23-15-11-9-12-16-23)35-25(34)36-31-21-28(5,6)33(29(7,8)22-31)38-24-17-13-10-14-18-24/h9-18H,19-22H2,1-8H3 |
| InChIKey | JXWLHKYWFLFDGT-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 48.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.81 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|