C15H24N2S — CID 134936181
2,2,6,6-tetramethyl-N-phenylsulfanylpiperidin-1-amine (PubChem CID 134936181) has the molecular formula C15H24N2S and a molecular weight of 264.44 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-N-phenylsulfanylpiperidin-1-amine.
| Compound Name | 2,2,6,6-tetramethyl-N-phenylsulfanylpiperidin-1-amine |
|---|---|
| PubChem CID | 134936181 |
| Molecular Formula | C15H24N2S |
| Molecular Weight | 264.44 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 2,2,6,6-tetramethyl-N-phenylsulfanylpiperidin-1-amine |
| SMILES | CC1(C)CCCC(C)(C)N1NSc1ccccc1 |
| InChI | InChI=1S/C15H24N2S/c1-14(2)11-8-12-15(3,4)17(14)16-18-13-9-6-5-7-10-13/h5-7,9-10,16H,8,11-12H2,1-4H3 |
| InChIKey | WHLRWKKBTQZILB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|