C35H62N2O4 — CID 70424655
2-[bis(1,2,2,6,6-pentamethylpiperidin-4-yl)methylidene]-3-dec-9-enylbutanedioic acid (PubChem CID 70424655) has the molecular formula C35H62N2O4 and a molecular weight of 574.89 g/mol. Its IUPAC name is 2-[bis(1,2,2,6,6-pentamethylpiperidin-4-yl)methylidene]-3-dec-9-enylbutanedioic acid.
| Compound Name | 2-[bis(1,2,2,6,6-pentamethylpiperidin-4-yl)methylidene]-3-dec-9-enylbutanedioic acid |
|---|---|
| PubChem CID | 70424655 |
| Molecular Formula | C35H62N2O4 |
| Molecular Weight | 574.89 g/mol |
| Exact Mass | 574.47 |
| IUPAC Name | 2-[bis(1,2,2,6,6-pentamethylpiperidin-4-yl)methylidene]-3-dec-9-enylbutanedioic acid |
| SMILES | C=CCCCCCCCCC(C(=O)O)C(C(=O)O)=C(C1CC(C)(C)N(C)C(C)(C)C1)C1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C35H62N2O4/c1-12-13-14-15-16-17-18-19-20-27(30(38)39)29(31(40)41)28(25-21-32(2,3)36(10)33(4,5)22-25)26-23-34(6,7)37(11)35(8,9)24-26/h12,25-27H,1,13-24H2,2-11H3,(H,38,39)(H,40,41) |
| InChIKey | PQYXECPGYNVCHK-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.89 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|