About 2-prop-2-enyldec-9-enoic acid
2-prop-2-enyldec-9-enoic acid (PubChem CID 90413259) has the molecular formula C13H22O2
and a molecular weight of 210.32 g/mol. Its IUPAC name is 2-prop-2-enyldec-9-enoic acid.
Molecular Properties
| Compound Name | 2-prop-2-enyldec-9-enoic acid |
| PubChem CID | 90413259 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 2-prop-2-enyldec-9-enoic acid |
| SMILES | C=CCCCCCCC(CC=C)C(=O)O |
| InChI | InChI=1S/C13H22O2/c1-3-5-6-7-8-9-11-12(10-4-2)13(14)15/h3-4,12H,1-2,5-11H2,(H,14,15) |
| InChIKey | VHRBZKMKLCUBJE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-2-enyldec-9-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-2-enyldec-9-enoic acid?
The IUPAC name of 2-prop-2-enyldec-9-enoic acid (CID 90413259) is 2-prop-2-enyldec-9-enoic acid.
What is the SMILES notation for 2-prop-2-enyldec-9-enoic acid?
The canonical SMILES for 2-prop-2-enyldec-9-enoic acid is C=CCCCCCCC(CC=C)C(=O)O.
What is the InChIKey of 2-prop-2-enyldec-9-enoic acid?
The InChIKey is VHRBZKMKLCUBJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O2/c1-3-5-6-7-8-9-11-12(10-4-2)13(14)15/h3-4,12H,1-2,5-11H2,(H,14,15).
What are the key properties of 2-prop-2-enyldec-9-enoic acid?
2-prop-2-enyldec-9-enoic acid has a molecular weight of 210.32 g/mol, XLogP of 3.79, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-enyldec-9-enoic acid is sourced from PubChem (CID 90413259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).