About sodium;2-hex-5-enylhexanedioic acid;hydride
sodium;2-hex-5-enylhexanedioic acid;hydride (PubChem CID 175176644) has the molecular formula C12H21NaO4
and a molecular weight of 252.29 g/mol. Its IUPAC name is sodium;2-hex-5-enylhexanedioic acid;hydride.
Molecular Properties
| Compound Name | sodium;2-hex-5-enylhexanedioic acid;hydride |
| PubChem CID | 175176644 |
| Molecular Formula | C12H21NaO4 |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | sodium;2-hex-5-enylhexanedioic acid;hydride |
| SMILES | C=CCCCCC(CCCC(=O)O)C(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C12H20O4.Na.H/c1-2-3-4-5-7-10(12(15)16)8-6-9-11(13)14;;/h2,10H,1,3-9H2,(H,13,14)(H,15,16);;/q;+1;-1 |
| InChIKey | BFPKKLVBPJGQIR-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze sodium;2-hex-5-enylhexanedioic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-hex-5-enylhexanedioic acid;hydride?
The IUPAC name of sodium;2-hex-5-enylhexanedioic acid;hydride (CID 175176644) is sodium;2-hex-5-enylhexanedioic acid;hydride.
What is the SMILES notation for sodium;2-hex-5-enylhexanedioic acid;hydride?
The canonical SMILES for sodium;2-hex-5-enylhexanedioic acid;hydride is C=CCCCCC(CCCC(=O)O)C(=O)O.[H-].[Na+].
What is the InChIKey of sodium;2-hex-5-enylhexanedioic acid;hydride?
The InChIKey is BFPKKLVBPJGQIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O4.Na.H/c1-2-3-4-5-7-10(12(15)16)8-6-9-11(13)14;;/h2,10H,1,3-9H2,(H,13,14)(H,15,16);;/q;+1;-1.
What are the key properties of sodium;2-hex-5-enylhexanedioic acid;hydride?
sodium;2-hex-5-enylhexanedioic acid;hydride has a molecular weight of 252.29 g/mol, XLogP of -0.19, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-hex-5-enylhexanedioic acid;hydride is sourced from PubChem (CID 175176644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).