C23H38N2O — CID 130231633
2-[[(3aR,7aR)-3-methyl-3a,4,5,6,7,7a-hexahydro-2H-benzimidazol-1-yl]methyl]-4,6-ditert-butylphenol (PubChem CID 130231633) has the molecular formula C23H38N2O and a molecular weight of 358.57 g/mol. Its IUPAC name is 2-[[(3aR,7aR)-3-methyl-3a,4,5,6,7,7a-hexahydro-2H-benzimidazol-1-yl]methyl]-4,6-ditert-butylphenol.
| Compound Name | 2-[[(3aR,7aR)-3-methyl-3a,4,5,6,7,7a-hexahydro-2H-benzimidazol-1-yl]methyl]-4,6-ditert-butylphenol |
|---|---|
| PubChem CID | 130231633 |
| Molecular Formula | C23H38N2O |
| Molecular Weight | 358.57 g/mol |
| Exact Mass | 358.30 |
| IUPAC Name | 2-[[(3aR,7aR)-3-methyl-3a,4,5,6,7,7a-hexahydro-2H-benzimidazol-1-yl]methyl]-4,6-ditert-butylphenol |
| SMILES | CN1CN(Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2O)[C@@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C23H38N2O/c1-22(2,3)17-12-16(21(26)18(13-17)23(4,5)6)14-25-15-24(7)19-10-8-9-11-20(19)25/h12-13,19-20,26H,8-11,14-15H2,1-7H3/t19-,20-/m1/s1 |
| InChIKey | FJFICTPKKYIEGK-WOJBJXKFSA-N |
| XLogP | 5.00 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.57 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|