C19H33NO — CID 20536288
4-(3-amino-2,2-dimethylpropyl)-2,6-ditert-butylphenol (PubChem CID 20536288) has the molecular formula C19H33NO and a molecular weight of 291.48 g/mol. Its IUPAC name is 4-(3-amino-2,2-dimethylpropyl)-2,6-ditert-butylphenol.
| Compound Name | 4-(3-amino-2,2-dimethylpropyl)-2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 20536288 |
| Molecular Formula | C19H33NO |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.26 |
| IUPAC Name | 4-(3-amino-2,2-dimethylpropyl)-2,6-ditert-butylphenol |
| SMILES | CC(C)(CN)Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H33NO/c1-17(2,3)14-9-13(11-19(7,8)12-20)10-15(16(14)21)18(4,5)6/h9-10,21H,11-12,20H2,1-8H3 |
| InChIKey | INIHPIRRNFIOPQ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |