C20H35NO — CID 170887995
4-(4-amino-2,2-dimethylbutyl)-2,6-ditert-butylphenol (PubChem CID 170887995) has the molecular formula C20H35NO and a molecular weight of 305.51 g/mol. Its IUPAC name is 4-(4-amino-2,2-dimethylbutyl)-2,6-ditert-butylphenol.
| Compound Name | 4-(4-amino-2,2-dimethylbutyl)-2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 170887995 |
| Molecular Formula | C20H35NO |
| Molecular Weight | 305.51 g/mol |
| Exact Mass | 305.27 |
| IUPAC Name | 4-(4-amino-2,2-dimethylbutyl)-2,6-ditert-butylphenol |
| SMILES | CC(C)(CCN)Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C20H35NO/c1-18(2,3)15-11-14(13-20(7,8)9-10-21)12-16(17(15)22)19(4,5)6/h11-12,22H,9-10,13,21H2,1-8H3 |
| InChIKey | VRYDSBQDTAFHIT-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.51 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |