C22H38Cl2N4O — CID 20536281
2,6-ditert-butyl-4-[3-[(3,5-dichloro-1,3,5-triazinan-1-yl)amino]-2,2-dimethylpropyl]phenol (PubChem CID 20536281) has the molecular formula C22H38Cl2N4O and a molecular weight of 445.48 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[3-[(3,5-dichloro-1,3,5-triazinan-1-yl)amino]-2,2-dimethylpropyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[3-[(3,5-dichloro-1,3,5-triazinan-1-yl)amino]-2,2-dimethylpropyl]phenol |
|---|---|
| PubChem CID | 20536281 |
| Molecular Formula | C22H38Cl2N4O |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | 2,6-ditert-butyl-4-[3-[(3,5-dichloro-1,3,5-triazinan-1-yl)amino]-2,2-dimethylpropyl]phenol |
| SMILES | CC(C)(CNN1CN(Cl)CN(Cl)C1)Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C22H38Cl2N4O/c1-20(2,3)17-9-16(10-18(19(17)29)21(4,5)6)11-22(7,8)12-25-28-14-26(23)13-27(24)15-28/h9-10,25,29H,11-15H2,1-8H3 |
| InChIKey | ICEGNWDFWDRRTC-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 41.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|