C31H52O — CID 121442924
2,6-ditert-butyl-4-[2-[4-(4-propylcyclohexyl)cyclohexyl]ethyl]phenol (PubChem CID 121442924) has the molecular formula C31H52O and a molecular weight of 440.76 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[2-[4-(4-propylcyclohexyl)cyclohexyl]ethyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[2-[4-(4-propylcyclohexyl)cyclohexyl]ethyl]phenol |
|---|---|
| PubChem CID | 121442924 |
| Molecular Formula | C31H52O |
| Molecular Weight | 440.76 g/mol |
| Exact Mass | 440.40 |
| IUPAC Name | 2,6-ditert-butyl-4-[2-[4-(4-propylcyclohexyl)cyclohexyl]ethyl]phenol |
| SMILES | CCCC1CCC(C2CCC(CCc3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)CC2)CC1 |
| InChI | InChI=1S/C31H52O/c1-8-9-22-12-16-25(17-13-22)26-18-14-23(15-19-26)10-11-24-20-27(30(2,3)4)29(32)28(21-24)31(5,6)7/h20-23,25-26,32H,8-19H2,1-7H3 |
| InChIKey | XXDCDCFDUFCUIC-UHFFFAOYSA-N |
| XLogP | 9.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.76 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |