C21H33O3 — CID 164702720
CID 164702720 (PubChem CID 164702720) has the molecular formula C21H33O3 and a molecular weight of 333.49 g/mol.
| Compound Name | CID 164702720 |
|---|---|
| PubChem CID | 164702720 |
| Molecular Formula | C21H33O3 |
| Molecular Weight | 333.49 g/mol |
| Exact Mass | 333.24 |
| IUPAC Name | — |
| SMILES | CCCC1CO[C](c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)OC1 |
| InChI | InChI=1S/C21H33O3/c1-8-9-14-12-23-19(24-13-14)15-10-16(20(2,3)4)18(22)17(11-15)21(5,6)7/h10-11,14,22H,8-9,12-13H2,1-7H3 |
| InChIKey | QLGNZFQJEFFGAD-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.49 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |