About CID 164702720
CID 164702720 (PubChem CID 164702720) has the molecular formula C21H33O3
and a molecular weight of 333.49 g/mol.
Molecular Properties
| Compound Name | CID 164702720 |
| PubChem CID | 164702720 |
| Molecular Formula | C21H33O3 |
| Molecular Weight | 333.49 g/mol |
| Exact Mass | 333.24 |
| IUPAC Name | — |
| SMILES | CCCC1CO[C](c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)OC1 |
| InChI | InChI=1S/C21H33O3/c1-8-9-14-12-23-19(24-13-14)15-10-16(20(2,3)4)18(22)17(11-15)21(5,6)7/h10-11,14,22H,8-9,12-13H2,1-7H3 |
| InChIKey | QLGNZFQJEFFGAD-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 333.49 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 164702720 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164702720?
The IUPAC name of CID 164702720 (CID 164702720) is not available.
What is the SMILES notation for CID 164702720?
The canonical SMILES for CID 164702720 is CCCC1CO[C](c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)OC1.
What is the InChIKey of CID 164702720?
The InChIKey is QLGNZFQJEFFGAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H33O3/c1-8-9-14-12-23-19(24-13-14)15-10-16(20(2,3)4)18(22)17(11-15)21(5,6)7/h10-11,14,22H,8-9,12-13H2,1-7H3.
What are the key properties of CID 164702720?
CID 164702720 has a molecular weight of 333.49 g/mol, XLogP of 5.29, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164702720 is sourced from PubChem (CID 164702720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).