C22H34O3 — CID 171758185
2,6-ditert-butyl-4-[5-(cyclopropylmethyl)-1,3-dioxan-2-yl]phenol (PubChem CID 171758185) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[5-(cyclopropylmethyl)-1,3-dioxan-2-yl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[5-(cyclopropylmethyl)-1,3-dioxan-2-yl]phenol |
|---|---|
| PubChem CID | 171758185 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | 2,6-ditert-butyl-4-[5-(cyclopropylmethyl)-1,3-dioxan-2-yl]phenol |
| SMILES | CC(C)(C)c1cc(C2OCC(CC3CC3)CO2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C22H34O3/c1-21(2,3)17-10-16(11-18(19(17)23)22(4,5)6)20-24-12-15(13-25-20)9-14-7-8-14/h10-11,14-15,20,23H,7-9,12-13H2,1-6H3 |
| InChIKey | GESWZIAWZJBQEK-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |