C19H30O3 — CID 155479617
2,6-ditert-butyl-4-[(3-methoxyoxetan-2-yl)methyl]phenol (PubChem CID 155479617) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(3-methoxyoxetan-2-yl)methyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[(3-methoxyoxetan-2-yl)methyl]phenol |
|---|---|
| PubChem CID | 155479617 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | 2,6-ditert-butyl-4-[(3-methoxyoxetan-2-yl)methyl]phenol |
| SMILES | COC1COC1Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H30O3/c1-18(2,3)13-8-12(10-15-16(21-7)11-22-15)9-14(17(13)20)19(4,5)6/h8-9,15-16,20H,10-11H2,1-7H3 |
| InChIKey | NNPLFMWYVQEEJA-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |